C24H27NO5 — CID 8977625
[(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-(4-acetyloxyphenyl)benzoate (PubChem CID 8977625) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-(4-acetyloxyphenyl)benzoate.
| Compound Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-(4-acetyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 8977625 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-(4-acetyloxyphenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)O[C@H](C)C(=O)N3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-17(23(27)25-15-5-3-4-6-16-25)29-24(28)21-9-7-19(8-10-21)20-11-13-22(14-12-20)30-18(2)26/h7-14,17H,3-6,15-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | KEKYPFLSUWDQSH-QGZVFWFLSA-N |
| XLogP | 4.23 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|