C22H15F2NO8S — CID 55307438
[2-(2,5-difluorophenyl)-2-oxoethyl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate (PubChem CID 55307438) has the molecular formula C22H15F2NO8S and a molecular weight of 491.42 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-2-oxoethyl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate.
| Compound Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 55307438 |
| Molecular Formula | C22H15F2NO8S |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Oc1ccc(C(=O)OCC(=O)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C22H15F2NO8S/c1-13-2-6-16(25(28)29)11-21(13)34(30,31)33-17-7-3-14(4-8-17)22(27)32-12-20(26)18-10-15(23)5-9-19(18)24/h2-11H,12H2,1H3 |
| InChIKey | QBQWQOLKRSYKAK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|