C16H15NO6S — CID 26526884
(4-acetylphenyl) 2,3-dimethyl-5-nitrobenzenesulfonate (PubChem CID 26526884) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is (4-acetylphenyl) 2,3-dimethyl-5-nitrobenzenesulfonate.
| Compound Name | (4-acetylphenyl) 2,3-dimethyl-5-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 26526884 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (4-acetylphenyl) 2,3-dimethyl-5-nitrobenzenesulfonate |
| SMILES | CC(=O)c1ccc(OS(=O)(=O)c2cc([N+](=O)[O-])cc(C)c2C)cc1 |
| InChI | InChI=1S/C16H15NO6S/c1-10-8-14(17(19)20)9-16(11(10)2)24(21,22)23-15-6-4-13(5-7-15)12(3)18/h4-9H,1-3H3 |
| InChIKey | DDWOPRXFPCCDPB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|