C23H26N2O8S — CID 51518485
[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate (PubChem CID 51518485) has the molecular formula C23H26N2O8S and a molecular weight of 490.53 g/mol. Its IUPAC name is [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate.
| Compound Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 51518485 |
| Molecular Formula | C23H26N2O8S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-(2-methyl-5-nitrophenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Oc1ccc(C(=O)OCC(=O)N2C[C@@H](C)C[C@H](C)C2)cc1 |
| InChI | InChI=1S/C23H26N2O8S/c1-15-10-16(2)13-24(12-15)22(26)14-32-23(27)18-5-8-20(9-6-18)33-34(30,31)21-11-19(25(28)29)7-4-17(21)3/h4-9,11,15-16H,10,12-14H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | WOKFVVLOLKEMAE-HOTGVXAUSA-N |
| XLogP | 3.33 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|