C19H19NO8 — CID 7291655
[(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 7291655) has the molecular formula C19H19NO8 and a molecular weight of 389.36 g/mol. Its IUPAC name is [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 7291655 |
| Molecular Formula | C19H19NO8 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1ccc(C(=O)[C@H](C)OC(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19NO8/c1-11(18(21)12-5-7-13(25-2)8-6-12)28-19(22)14-9-16(26-3)17(27-4)10-15(14)20(23)24/h5-11H,1-4H3/t11-/m0/s1 |
| InChIKey | PTWKYFDJUSVBSF-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|