C20H21FN2O7 — CID 7583173
[(2S)-1-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 7583173) has the molecular formula C20H21FN2O7 and a molecular weight of 420.39 g/mol. Its IUPAC name is [(2S)-1-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [(2S)-1-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 7583173 |
| Molecular Formula | C20H21FN2O7 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [(2S)-1-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)O[C@@H](C)C(=O)N[C@@H](C)c2ccc(F)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H21FN2O7/c1-11(13-5-7-14(21)8-6-13)22-19(24)12(2)30-20(25)15-9-17(28-3)18(29-4)10-16(15)23(26)27/h5-12H,1-4H3,(H,22,24)/t11-,12-/m0/s1 |
| InChIKey | MRHKLTAXWMVVLU-RYUDHWBXSA-N |
| XLogP | 3.17 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|