C24H22N2O8 — CID 2472710
[(2R)-1-oxo-1-(4-phenoxyanilino)propan-2-yl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 2472710) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-phenoxyanilino)propan-2-yl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [(2R)-1-oxo-1-(4-phenoxyanilino)propan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 2472710 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(2R)-1-oxo-1-(4-phenoxyanilino)propan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)O[C@H](C)C(=O)Nc2ccc(Oc3ccccc3)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H22N2O8/c1-15(33-24(28)19-13-21(31-2)22(32-3)14-20(19)26(29)30)23(27)25-16-9-11-18(12-10-16)34-17-7-5-4-6-8-17/h4-15H,1-3H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | SPEWSPGNGVBERY-OAHLLOKOSA-N |
| XLogP | 4.59 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|