C19H17N3O7 — CID 7583024
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 7583024) has the molecular formula C19H17N3O7 and a molecular weight of 399.36 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 7583024 |
| Molecular Formula | C19H17N3O7 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)O[C@@H](C)C(=O)Nc2cccc(C#N)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H17N3O7/c1-11(18(23)21-13-6-4-5-12(7-13)10-20)29-19(24)14-8-16(27-2)17(28-3)9-15(14)22(25)26/h4-9,11H,1-3H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | OLYQADAMIPPVRL-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|