C19H18N4O5 — CID 7684711
[(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 7684711) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7684711 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1cc([N+](=O)[O-])ccc1N(C)C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H18N4O5/c1-12(18(24)21-14-6-4-5-13(9-14)11-20)28-19(25)16-10-15(23(26)27)7-8-17(16)22(2)3/h4-10,12H,1-3H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | QAXXXXCMPMZELN-GFCCVEGCSA-N |
| XLogP | 2.72 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|