C18H14F2N2O7 — CID 8940039
[(2S)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 8940039) has the molecular formula C18H14F2N2O7 and a molecular weight of 408.31 g/mol. Its IUPAC name is [(2S)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [(2S)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 8940039 |
| Molecular Formula | C18H14F2N2O7 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [(2S)-1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H14F2N2O7/c1-9(17(23)21-13-6-10(19)2-3-12(13)20)29-18(24)11-7-15-16(28-5-4-27-15)8-14(11)22(25)26/h2-3,6-9H,4-5H2,1H3,(H,21,23)/t9-/m0/s1 |
| InChIKey | YQCQYDPKSDGAPZ-VIFPVBQESA-N |
| XLogP | 2.83 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|