C16H10F2N2O7 — CID 18193920
[2-(2,6-difluoroanilino)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 18193920) has the molecular formula C16H10F2N2O7 and a molecular weight of 380.26 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18193920 |
| Molecular Formula | C16H10F2N2O7 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(cc1[N+](=O)[O-])OCO2)Nc1c(F)cccc1F |
| InChI | InChI=1S/C16H10F2N2O7/c17-9-2-1-3-10(18)15(9)19-14(21)6-25-16(22)8-4-12-13(27-7-26-12)5-11(8)20(23)24/h1-5H,6-7H2,(H,19,21) |
| InChIKey | DDKGPIQZRSPUBE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|