C17H14N2O7S — CID 18193937
[2-(2-methylsulfanylanilino)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 18193937) has the molecular formula C17H14N2O7S and a molecular weight of 390.37 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18193937 |
| Molecular Formula | C17H14N2O7S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | CSc1ccccc1NC(=O)COC(=O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C17H14N2O7S/c1-27-15-5-3-2-4-11(15)18-16(20)8-24-17(21)10-6-13-14(26-9-25-13)7-12(10)19(22)23/h2-7H,8-9H2,1H3,(H,18,20) |
| InChIKey | ZUDPXRISZANHOQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|