C25H26N2O7 — CID 5001156
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 5001156) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 5001156 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)c2cc1C(C)C |
| InChI | InChI=1S/C25H26N2O7/c1-15(2)19-13-20-18(12-24(28)34-23(20)10-16(19)3)14-33-25(29)17-4-5-21(22(11-17)27(30)31)26-6-8-32-9-7-26/h4-5,10-13,15H,6-9,14H2,1-3H3 |
| InChIKey | MEBOBEYBDRORHE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|