C22H20F3NO5 — CID 42378552
2-(2-oxo-4-propylchromen-7-yl)oxy-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 42378552) has the molecular formula C22H20F3NO5 and a molecular weight of 435.40 g/mol. Its IUPAC name is 2-(2-oxo-4-propylchromen-7-yl)oxy-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(2-oxo-4-propylchromen-7-yl)oxy-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 42378552 |
| Molecular Formula | C22H20F3NO5 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-(2-oxo-4-propylchromen-7-yl)oxy-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CCCc1cc(=O)oc2cc(OCC(=O)NCc3ccccc3OC(F)(F)F)ccc12 |
| InChI | InChI=1S/C22H20F3NO5/c1-2-5-14-10-21(28)30-19-11-16(8-9-17(14)19)29-13-20(27)26-12-15-6-3-4-7-18(15)31-22(23,24)25/h3-4,6-11H,2,5,12-13H2,1H3,(H,26,27) |
| InChIKey | PQEPIGFRNDULPD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|