C21H21NO6S — CID 9353959
N-(2-methylsulfonylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide (PubChem CID 9353959) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-(2-methylsulfonylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide.
| Compound Name | N-(2-methylsulfonylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 9353959 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-(2-methylsulfonylphenyl)-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide |
| SMILES | CCCc1cc(=O)oc2cc(OCC(=O)Nc3ccccc3S(C)(=O)=O)ccc12 |
| InChI | InChI=1S/C21H21NO6S/c1-3-6-14-11-21(24)28-18-12-15(9-10-16(14)18)27-13-20(23)22-17-7-4-5-8-19(17)29(2,25)26/h4-5,7-12H,3,6,13H2,1-2H3,(H,22,23) |
| InChIKey | VFYAZAWYMXBDRS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|