C38H41N3O9 — CID 164577203
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[2-[4-methyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxochromen-3-yl]acetyl]amino]hexanoic acid (PubChem CID 164577203) has the molecular formula C38H41N3O9 and a molecular weight of 683.76 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[2-[4-methyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxochromen-3-yl]acetyl]amino]hexanoic acid.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[2-[4-methyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxochromen-3-yl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 164577203 |
| Molecular Formula | C38H41N3O9 |
| Molecular Weight | 683.76 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[2-[4-methyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxochromen-3-yl]acetyl]amino]hexanoic acid |
| SMILES | Cc1c(CC(=O)NCCCC[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c(=O)oc2cc(NC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C38H41N3O9/c1-22-24-17-16-23(40-37(47)50-38(2,3)4)19-32(24)49-35(45)29(22)20-33(42)39-18-10-9-15-31(34(43)44)41-36(46)48-21-30-27-13-7-5-11-25(27)26-12-6-8-14-28(26)30/h5-8,11-14,16-17,19,30-31H,9-10,15,18,20-21H2,1-4H3,(H,39,42)(H,40,47)(H,41,46)(H,43,44)/t31-/m1/s1 |
| InChIKey | MIJQOZCHGVDENZ-WJOKGBTCSA-N |
| XLogP | 6.27 |
| TPSA | 173.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.76 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|