C22H20N2O4 — CID 143406639
9H-fluoren-9-ylmethyl N-[4-(hydroxycarbamoyl)cyclohexa-1,3-dien-1-yl]carbamate (PubChem CID 143406639) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(hydroxycarbamoyl)cyclohexa-1,3-dien-1-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(hydroxycarbamoyl)cyclohexa-1,3-dien-1-yl]carbamate |
|---|---|
| PubChem CID | 143406639 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(hydroxycarbamoyl)cyclohexa-1,3-dien-1-yl]carbamate |
| SMILES | O=C(NC1=CC=C(C(=O)NO)CC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H20N2O4/c25-21(24-27)14-9-11-15(12-10-14)23-22(26)28-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-9,11,20,27H,10,12-13H2,(H,23,26)(H,24,25) |
| InChIKey | GHMJGPAXPYUHQL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|