C26H40N2O7 — CID 86714692
ditert-butyl (2S)-2-[[(2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoyl]amino]butanedioate (PubChem CID 86714692) has the molecular formula C26H40N2O7 and a molecular weight of 492.61 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoyl]amino]butanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 86714692 |
| Molecular Formula | C26H40N2O7 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoyl]amino]butanedioate |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H40N2O7/c1-17(2)21(28(9)24(32)33-16-18-13-11-10-12-14-18)22(30)27-19(23(31)35-26(6,7)8)15-20(29)34-25(3,4)5/h10-14,17,19,21H,15-16H2,1-9H3,(H,27,30)/t19-,21-/m0/s1 |
| InChIKey | QFPRVPPFGUBCNU-FPOVZHCZSA-N |
| XLogP | 3.84 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|