C29H36N4O2S — CID 171410662
2,6-diamino-N-[1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]hexanamide (PubChem CID 171410662) has the molecular formula C29H36N4O2S and a molecular weight of 504.70 g/mol. Its IUPAC name is 2,6-diamino-N-[1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]hexanamide.
| Compound Name | 2,6-diamino-N-[1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 171410662 |
| Molecular Formula | C29H36N4O2S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 2,6-diamino-N-[1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]hexanamide |
| SMILES | CNC(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(N)CCCCN |
| InChI | InChI=1S/C29H36N4O2S/c1-32-28(35)26(33-27(34)25(31)19-11-12-20-30)21-36-29(22-13-5-2-6-14-22,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h2-10,13-18,25-26H,11-12,19-21,30-31H2,1H3,(H,32,35)(H,33,34) |
| InChIKey | UJKKIBNBLABRIV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|