C24H25N3O3S — CID 171534305
N-[(2S)-1-[[(3S)-5-methylsulfinylpent-1-yn-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]-1H-indole-2-carboxamide (PubChem CID 171534305) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[(2S)-1-[[(3S)-5-methylsulfinylpent-1-yn-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(3S)-5-methylsulfinylpent-1-yn-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 171534305 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[(2S)-1-[[(3S)-5-methylsulfinylpent-1-yn-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]-1H-indole-2-carboxamide |
| SMILES | C#C[C@H](CCS(C)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H25N3O3S/c1-3-19(13-14-31(2)30)25-23(28)21(15-17-9-5-4-6-10-17)27-24(29)22-16-18-11-7-8-12-20(18)26-22/h1,4-12,16,19,21,26H,13-15H2,2H3,(H,25,28)(H,27,29)/t19-,21+,31?/m1/s1 |
| InChIKey | WBTKZMKXTJTADT-AIECAEIUSA-N |
| XLogP | 2.40 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|