C24H26FN3O3 — CID 171530259
N-[(2S)-1-[[1-(4-fluorophenyl)-3-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1H-indole-2-carboxamide (PubChem CID 171530259) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[(2S)-1-[[1-(4-fluorophenyl)-3-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[[1-(4-fluorophenyl)-3-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 171530259 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[(2S)-1-[[1-(4-fluorophenyl)-3-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1H-indole-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cc2ccccc2[nH]1)C(=O)NC(C=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H26FN3O3/c1-15(2)11-21(28-24(31)22-13-17-5-3-4-6-20(17)27-22)23(30)26-19(14-29)12-16-7-9-18(25)10-8-16/h3-10,13-15,19,21,27H,11-12H2,1-2H3,(H,26,30)(H,28,31)/t19?,21-/m0/s1 |
| InChIKey | ZDDPNMZBWIUGLY-QWAKEFERSA-N |
| XLogP | 3.38 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|