C25H20N4O6 — CID 11305968
2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-(2-nitrophenyl)propanoic acid (PubChem CID 11305968) has the molecular formula C25H20N4O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-(2-nitrophenyl)propanoic acid.
| Compound Name | 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-(2-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 11305968 |
| Molecular Formula | C25H20N4O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-(2-nitrophenyl)propanoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)NC(Cc1ccccc1[N+](=O)[O-])C(=O)O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H20N4O6/c30-23(28-21(25(32)33)14-16-8-2-6-12-22(16)29(34)35)17-9-3-5-11-19(17)27-24(31)20-13-15-7-1-4-10-18(15)26-20/h1-13,21,26H,14H2,(H,27,31)(H,28,30)(H,32,33) |
| InChIKey | RXLITYGVMVCPCC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 154.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|