C12H13N3O6 — CID 170436802
(2S)-6-diazo-2-[[(2S)-2-(furan-2-yl)-2-hydroxyacetyl]amino]-5-oxohexanoic acid (PubChem CID 170436802) has the molecular formula C12H13N3O6 and a molecular weight of 295.25 g/mol. Its IUPAC name is (2S)-6-diazo-2-[[(2S)-2-(furan-2-yl)-2-hydroxyacetyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-diazo-2-[[(2S)-2-(furan-2-yl)-2-hydroxyacetyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436802 |
| Molecular Formula | C12H13N3O6 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (2S)-6-diazo-2-[[(2S)-2-(furan-2-yl)-2-hydroxyacetyl]amino]-5-oxohexanoic acid |
| SMILES | [N-]=[N+]=CC(=O)CC[C@H](NC(=O)[C@@H](O)c1ccco1)C(=O)O |
| InChI | InChI=1S/C12H13N3O6/c13-14-6-7(16)3-4-8(12(19)20)15-11(18)10(17)9-2-1-5-21-9/h1-2,5-6,8,10,17H,3-4H2,(H,15,18)(H,19,20)/t8-,10-/m0/s1 |
| InChIKey | JIJPQLDUGMJNDG-WPRPVWTQSA-N |
| XLogP | -0.47 |
| TPSA | 153.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|