C13H13FN4O5 — CID 170437055
(2S)-6-diazo-2-[[(2R)-2-(5-fluoro-2-pyridinyl)-2-hydroxyacetyl]amino]-5-oxohexanoic acid (PubChem CID 170437055) has the molecular formula C13H13FN4O5 and a molecular weight of 324.27 g/mol. Its IUPAC name is (2S)-6-diazo-2-[[(2R)-2-(5-fluoro-2-pyridinyl)-2-hydroxyacetyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-diazo-2-[[(2R)-2-(5-fluoro-2-pyridinyl)-2-hydroxyacetyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170437055 |
| Molecular Formula | C13H13FN4O5 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (2S)-6-diazo-2-[[(2R)-2-(5-fluoro-2-pyridinyl)-2-hydroxyacetyl]amino]-5-oxohexanoic acid |
| SMILES | [N-]=[N+]=CC(=O)CC[C@H](NC(=O)[C@H](O)c1ccc(F)cn1)C(=O)O |
| InChI | InChI=1S/C13H13FN4O5/c14-7-1-3-9(16-5-7)11(20)12(21)18-10(13(22)23)4-2-8(19)6-17-15/h1,3,5-6,10-11,20H,2,4H2,(H,18,21)(H,22,23)/t10-,11+/m0/s1 |
| InChIKey | IMEMUSOYSBTSLY-WDEREUQCSA-N |
| XLogP | -0.53 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|