C20H34N4O6 — CID 167000760
ethyl 2-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-imino-5-oxohexanoyl]amino]-2-methylpropanoate (PubChem CID 167000760) has the molecular formula C20H34N4O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-imino-5-oxohexanoyl]amino]-2-methylpropanoate.
| Compound Name | ethyl 2-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-imino-5-oxohexanoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 167000760 |
| Molecular Formula | C20H34N4O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | ethyl 2-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-imino-5-oxohexanoyl]amino]-2-methylpropanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)NC(C)(C)C(=O)OCC |
| InChI | InChI=1S/C20H34N4O6/c1-7-30-19(29)20(5,6)24-18(28)15(9-8-14(26)11-21)23-17(27)16(10-12(2)3)22-13(4)25/h11-12,15-16,21H,7-10H2,1-6H3,(H,22,25)(H,23,27)(H,24,28)/b21-11+/t15-,16-/m0/s1 |
| InChIKey | NXIZSEWBVRVMCW-BBQGRHSISA-N |
| XLogP | 0.48 |
| TPSA | 154.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|