C21H34N4O6 — CID 167000723
ethyl 1-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-imino-5-oxohexanoyl]amino]cyclobutane-1-carboxylate (PubChem CID 167000723) has the molecular formula C21H34N4O6 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl 1-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-imino-5-oxohexanoyl]amino]cyclobutane-1-carboxylate.
| Compound Name | ethyl 1-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-imino-5-oxohexanoyl]amino]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 167000723 |
| Molecular Formula | C21H34N4O6 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | ethyl 1-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-imino-5-oxohexanoyl]amino]cyclobutane-1-carboxylate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)NC1(C(=O)OCC)CCC1 |
| InChI | InChI=1S/C21H34N4O6/c1-5-31-20(30)21(9-6-10-21)25-19(29)16(8-7-15(27)12-22)24-18(28)17(11-13(2)3)23-14(4)26/h12-13,16-17,22H,5-11H2,1-4H3,(H,23,26)(H,24,28)(H,25,29)/b22-12+/t16-,17-/m0/s1 |
| InChIKey | IQAFQZYHTYBAAF-QSBCOWLBSA-N |
| XLogP | 0.62 |
| TPSA | 154.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|