C35H47N5O7 — CID 153440057
ethyl 6-diazo-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-1-hydroxy-4-methylpentyl]amino]-4-methylpentanoyl]amino]-5-oxohexanoate (PubChem CID 153440057) has the molecular formula C35H47N5O7 and a molecular weight of 649.79 g/mol. Its IUPAC name is ethyl 6-diazo-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-1-hydroxy-4-methylpentyl]amino]-4-methylpentanoyl]amino]-5-oxohexanoate.
| Compound Name | ethyl 6-diazo-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-1-hydroxy-4-methylpentyl]amino]-4-methylpentanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 153440057 |
| Molecular Formula | C35H47N5O7 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | ethyl 6-diazo-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-1-hydroxy-4-methylpentyl]amino]-4-methylpentanoyl]amino]-5-oxohexanoate |
| SMILES | CCOC(=O)C(CCC(=O)C=[N+]=[N-])NC(=O)C(CC(C)C)NC(O)C(CC(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H47N5O7/c1-6-46-34(44)29(16-15-23(41)19-37-36)38-32(42)30(17-21(2)3)39-33(43)31(18-22(4)5)40-35(45)47-20-28-26-13-9-7-11-24(26)25-12-8-10-14-27(25)28/h7-14,19,21-22,28-31,33,39,43H,6,15-18,20H2,1-5H3,(H,38,42)(H,40,45) |
| InChIKey | XEFDARRHJGWBEI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 179.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|