C33H41N5O7 — CID 137039678
2-[[2-[[2-[[5-diazo-1-(9H-fluoren-9-yl)-4-oxopentoxy]carbonylamino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]acetic acid (PubChem CID 137039678) has the molecular formula C33H41N5O7 and a molecular weight of 619.72 g/mol. Its IUPAC name is 2-[[2-[[2-[[5-diazo-1-(9H-fluoren-9-yl)-4-oxopentoxy]carbonylamino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[5-diazo-1-(9H-fluoren-9-yl)-4-oxopentoxy]carbonylamino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 137039678 |
| Molecular Formula | C33H41N5O7 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | 2-[[2-[[2-[[5-diazo-1-(9H-fluoren-9-yl)-4-oxopentoxy]carbonylamino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
| SMILES | CC(C)CC(NC(=O)OC(CCC(=O)C=[N+]=[N-])C1c2ccccc2-c2ccccc21)C(=O)NC(CC(C)C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C33H41N5O7/c1-19(2)15-26(31(42)35-18-29(40)41)37-32(43)27(16-20(3)4)38-33(44)45-28(14-13-21(39)17-36-34)30-24-11-7-5-9-22(24)23-10-6-8-12-25(23)30/h5-12,17,19-20,26-28,30H,13-16,18H2,1-4H3,(H,35,42)(H,37,43)(H,38,44)(H,40,41) |
| InChIKey | UATOOEUNEBQTFP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 187.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|