C27H37N7O7 — CID 90010551
2-[[2-[2-[[4-(3-azidopropylamino)-4-oxo-1-phenylbutoxy]carbonylamino]pent-4-ynoylamino]-4-methylpentanoyl]amino]acetic acid (PubChem CID 90010551) has the molecular formula C27H37N7O7 and a molecular weight of 571.64 g/mol. Its IUPAC name is 2-[[2-[2-[[4-(3-azidopropylamino)-4-oxo-1-phenylbutoxy]carbonylamino]pent-4-ynoylamino]-4-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-[[4-(3-azidopropylamino)-4-oxo-1-phenylbutoxy]carbonylamino]pent-4-ynoylamino]-4-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 90010551 |
| Molecular Formula | C27H37N7O7 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 2-[[2-[2-[[4-(3-azidopropylamino)-4-oxo-1-phenylbutoxy]carbonylamino]pent-4-ynoylamino]-4-methylpentanoyl]amino]acetic acid |
| SMILES | C#CCC(NC(=O)OC(CCC(=O)NCCCN=[N+]=[N-])c1ccccc1)C(=O)NC(CC(C)C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C27H37N7O7/c1-4-9-20(26(39)32-21(16-18(2)3)25(38)30-17-24(36)37)33-27(40)41-22(19-10-6-5-7-11-19)12-13-23(35)29-14-8-15-31-34-28/h1,5-7,10-11,18,20-22H,8-9,12-17H2,2-3H3,(H,29,35)(H,30,38)(H,32,39)(H,33,40)(H,36,37) |
| InChIKey | LTANTFUPFHLLFT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 211.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|