C19H24N2O5 — CID 78106116
4-methyl-2-[2-(phenylmethoxycarbonylamino)pent-4-ynoylamino]pentanoic acid (PubChem CID 78106116) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-methyl-2-[2-(phenylmethoxycarbonylamino)pent-4-ynoylamino]pentanoic acid.
| Compound Name | 4-methyl-2-[2-(phenylmethoxycarbonylamino)pent-4-ynoylamino]pentanoic acid |
|---|---|
| PubChem CID | 78106116 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-methyl-2-[2-(phenylmethoxycarbonylamino)pent-4-ynoylamino]pentanoic acid |
| SMILES | C#CCC(NC(=O)OCc1ccccc1)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C19H24N2O5/c1-4-8-15(17(22)20-16(18(23)24)11-13(2)3)21-19(25)26-12-14-9-6-5-7-10-14/h1,5-7,9-10,13,15-16H,8,11-12H2,2-3H3,(H,20,22)(H,21,25)(H,23,24) |
| InChIKey | AVYYYGZWDJPHFK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|