C33H40N4O9 — CID 166076154
prop-2-enyl 3-[2-[2-[2-[[(2S)-6-diazo-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxohexanoyl]amino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 166076154) has the molecular formula C33H40N4O9 and a molecular weight of 636.70 g/mol. Its IUPAC name is prop-2-enyl 3-[2-[2-[2-[[(2S)-6-diazo-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxohexanoyl]amino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | prop-2-enyl 3-[2-[2-[2-[[(2S)-6-diazo-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxohexanoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 166076154 |
| Molecular Formula | C33H40N4O9 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | prop-2-enyl 3-[2-[2-[2-[[(2S)-6-diazo-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxohexanoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | C=CCOC(=O)CCOCCOCCOCCNC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H40N4O9/c1-2-15-45-31(39)13-16-42-18-20-44-21-19-43-17-14-35-32(40)30(12-11-24(38)22-36-34)37-33(41)46-23-29-27-9-5-3-7-25(27)26-8-4-6-10-28(26)29/h2-10,22,29-30H,1,11-21,23H2,(H,35,40)(H,37,41)/t30-/m0/s1 |
| InChIKey | PQNQAPWRAAQDIY-PMERELPUSA-N |
| XLogP | 2.83 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|