C28H31N3O8 — CID 171841898
prop-2-enyl (4S)-5-(acetyloxymethylamino)-4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-oxopentanoate (PubChem CID 171841898) has the molecular formula C28H31N3O8 and a molecular weight of 537.57 g/mol. Its IUPAC name is prop-2-enyl (4S)-5-(acetyloxymethylamino)-4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-oxopentanoate.
| Compound Name | prop-2-enyl (4S)-5-(acetyloxymethylamino)-4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 171841898 |
| Molecular Formula | C28H31N3O8 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | prop-2-enyl (4S)-5-(acetyloxymethylamino)-4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-oxopentanoate |
| SMILES | C=CCOC(=O)CC[C@H](NC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCOC(C)=O |
| InChI | InChI=1S/C28H31N3O8/c1-3-14-37-26(34)13-12-24(27(35)30-17-39-18(2)32)31-25(33)15-29-28(36)38-16-23-21-10-6-4-8-19(21)20-9-5-7-11-22(20)23/h3-11,23-24H,1,12-17H2,2H3,(H,29,36)(H,30,35)(H,31,33)/t24-/m0/s1 |
| InChIKey | DTUZTHGXVLHCEZ-DEOSSOPVSA-N |
| XLogP | 2.16 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|