C31H35N3O6 — CID 175100167
1-O-tert-butyl 5-O-prop-2-enyl 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]imidazol-1-yl]pentanedioate (PubChem CID 175100167) has the molecular formula C31H35N3O6 and a molecular weight of 545.64 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-prop-2-enyl 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]imidazol-1-yl]pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-prop-2-enyl 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]imidazol-1-yl]pentanedioate |
|---|---|
| PubChem CID | 175100167 |
| Molecular Formula | C31H35N3O6 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 1-O-tert-butyl 5-O-prop-2-enyl 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]imidazol-1-yl]pentanedioate |
| SMILES | C=CCOC(=O)CCC(C(=O)OC(C)(C)C)n1cnc(CNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C31H35N3O6/c1-5-16-38-28(35)15-14-27(29(36)40-31(2,3)4)34-18-21(33-20-34)17-32-30(37)39-19-26-24-12-8-6-10-22(24)23-11-7-9-13-25(23)26/h5-13,18,20,26-27H,1,14-17,19H2,2-4H3,(H,32,37) |
| InChIKey | MFPHSQYPGWBHPU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|