C9H14N4O2S — CID 110694057
N-(2-acetamidoethyl)-2-(1,3-thiazol-2-ylamino)acetamide (PubChem CID 110694057) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(1,3-thiazol-2-ylamino)acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-(1,3-thiazol-2-ylamino)acetamide |
|---|---|
| PubChem CID | 110694057 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(1,3-thiazol-2-ylamino)acetamide |
| SMILES | CC(=O)NCCNC(=O)CNc1nccs1 |
| InChI | InChI=1S/C9H14N4O2S/c1-7(14)10-2-3-11-8(15)6-13-9-12-4-5-16-9/h4-5H,2-3,6H2,1H3,(H,10,14)(H,11,15)(H,12,13) |
| InChIKey | AUBCWHUKCFHSEB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|