C7H12ClN3S — CID 83156277
N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine (PubChem CID 83156277) has the molecular formula C7H12ClN3S and a molecular weight of 205.71 g/mol. Its IUPAC name is N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine.
| Compound Name | N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 83156277 |
| Molecular Formula | C7H12ClN3S |
| Molecular Weight | 205.71 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine |
| SMILES | CCNCCNc1nc(Cl)cs1 |
| InChI | InChI=1S/C7H12ClN3S/c1-2-9-3-4-10-7-11-6(8)5-12-7/h5,9H,2-4H2,1H3,(H,10,11) |
| InChIKey | FOFYRSMDMRSQAB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.71 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|