About N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine
N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine (PubChem CID 83156277) has the molecular formula C7H12ClN3S
and a molecular weight of 205.71 g/mol. Its IUPAC name is N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine |
| PubChem CID | 83156277 |
| Molecular Formula | C7H12ClN3S |
| Molecular Weight | 205.71 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine |
| SMILES | CCNCCNc1nc(Cl)cs1 |
| InChI | InChI=1S/C7H12ClN3S/c1-2-9-3-4-10-7-11-6(8)5-12-7/h5,9H,2-4H2,1H3,(H,10,11) |
| InChIKey | FOFYRSMDMRSQAB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.71 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine?
The IUPAC name of N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine (CID 83156277) is N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine.
What is the SMILES notation for N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine?
The canonical SMILES for N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine is CCNCCNc1nc(Cl)cs1.
What is the InChIKey of N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine?
The InChIKey is FOFYRSMDMRSQAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClN3S/c1-2-9-3-4-10-7-11-6(8)5-12-7/h5,9H,2-4H2,1H3,(H,10,11).
What are the key properties of N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine?
N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine has a molecular weight of 205.71 g/mol, XLogP of 1.82, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-chloro-1,3-thiazol-2-yl)-N-ethylethane-1,2-diamine is sourced from PubChem (CID 83156277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).