C12H13ClN2OS — CID 83153478
4-chloro-N-[2-(4-methoxyphenyl)ethyl]-1,3-thiazol-2-amine (PubChem CID 83153478) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-methoxyphenyl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-[2-(4-methoxyphenyl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83153478 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 4-chloro-N-[2-(4-methoxyphenyl)ethyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(CCNc2nc(Cl)cs2)cc1 |
| InChI | InChI=1S/C12H13ClN2OS/c1-16-10-4-2-9(3-5-10)6-7-14-12-15-11(13)8-17-12/h2-5,8H,6-7H2,1H3,(H,14,15) |
| InChIKey | WJUNUTIQMMXPGB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |