C7H13N3OS — CID 84761905
3-[[4-(aminomethyl)-1,3-thiazol-2-yl]amino]propan-1-ol (PubChem CID 84761905) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is 3-[[4-(aminomethyl)-1,3-thiazol-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4-(aminomethyl)-1,3-thiazol-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 84761905 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 3-[[4-(aminomethyl)-1,3-thiazol-2-yl]amino]propan-1-ol |
| SMILES | NCc1csc(NCCCO)n1 |
| InChI | InChI=1S/C7H13N3OS/c8-4-6-5-12-7(10-6)9-2-1-3-11/h5,11H,1-4,8H2,(H,9,10) |
| InChIKey | ZZTARAVLJQKNMA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|