C13H26N4S — CID 84761995
N-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N',N'-diethylbutane-1,4-diamine (PubChem CID 84761995) has the molecular formula C13H26N4S and a molecular weight of 270.45 g/mol. Its IUPAC name is N-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N',N'-diethylbutane-1,4-diamine.
| Compound Name | N-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N',N'-diethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 84761995 |
| Molecular Formula | C13H26N4S |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N',N'-diethylbutane-1,4-diamine |
| SMILES | CCN(CC)CCCCNc1nc(CCN)cs1 |
| InChI | InChI=1S/C13H26N4S/c1-3-17(4-2)10-6-5-9-15-13-16-12(7-8-14)11-18-13/h11H,3-10,14H2,1-2H3,(H,15,16) |
| InChIKey | LNCLNIHZHVIQMS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|