C18H16N4O3S — CID 139811841
N-(2-aminophenyl)-4-(pyridin-3-ylsulfonylamino)benzamide (PubChem CID 139811841) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-(pyridin-3-ylsulfonylamino)benzamide.
| Compound Name | N-(2-aminophenyl)-4-(pyridin-3-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 139811841 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-(2-aminophenyl)-4-(pyridin-3-ylsulfonylamino)benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NS(=O)(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c19-16-5-1-2-6-17(16)21-18(23)13-7-9-14(10-8-13)22-26(24,25)15-4-3-11-20-12-15/h1-12,22H,19H2,(H,21,23) |
| InChIKey | ZMJZKCLXULQPKQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|