C40H50N6O2 — CID 70184942
1-benzyl-1-[[(1S,3S)-3-[[benzyl-[[4-(dimethylamino)phenyl]carbamoyl]amino]methyl]cyclohexyl]methyl]-3-[4-(dimethylamino)phenyl]urea (PubChem CID 70184942) has the molecular formula C40H50N6O2 and a molecular weight of 646.88 g/mol. Its IUPAC name is 1-benzyl-1-[[(1S,3S)-3-[[benzyl-[[4-(dimethylamino)phenyl]carbamoyl]amino]methyl]cyclohexyl]methyl]-3-[4-(dimethylamino)phenyl]urea.
| Compound Name | 1-benzyl-1-[[(1S,3S)-3-[[benzyl-[[4-(dimethylamino)phenyl]carbamoyl]amino]methyl]cyclohexyl]methyl]-3-[4-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 70184942 |
| Molecular Formula | C40H50N6O2 |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.40 |
| IUPAC Name | 1-benzyl-1-[[(1S,3S)-3-[[benzyl-[[4-(dimethylamino)phenyl]carbamoyl]amino]methyl]cyclohexyl]methyl]-3-[4-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)N(Cc2ccccc2)C[C@H]2CCC[C@H](CN(Cc3ccccc3)C(=O)Nc3ccc(N(C)C)cc3)C2)cc1 |
| InChI | InChI=1S/C40H50N6O2/c1-43(2)37-22-18-35(19-23-37)41-39(47)45(27-31-12-7-5-8-13-31)29-33-16-11-17-34(26-33)30-46(28-32-14-9-6-10-15-32)40(48)42-36-20-24-38(25-21-36)44(3)4/h5-10,12-15,18-25,33-34H,11,16-17,26-30H2,1-4H3,(H,41,47)(H,42,48)/t33-,34-/m0/s1 |
| InChIKey | LVKJYVAVSCWYDE-HEVIKAOCSA-N |
| XLogP | 8.39 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|