C38H62N6O2 — CID 70184922
3-[4-(dimethylamino)phenyl]-1-[[(1S,3S)-3-[[[4-(dimethylamino)phenyl]carbamoyl-hexylamino]methyl]cyclohexyl]methyl]-1-hexylurea (PubChem CID 70184922) has the molecular formula C38H62N6O2 and a molecular weight of 634.95 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-1-[[(1S,3S)-3-[[[4-(dimethylamino)phenyl]carbamoyl-hexylamino]methyl]cyclohexyl]methyl]-1-hexylurea.
| Compound Name | 3-[4-(dimethylamino)phenyl]-1-[[(1S,3S)-3-[[[4-(dimethylamino)phenyl]carbamoyl-hexylamino]methyl]cyclohexyl]methyl]-1-hexylurea |
|---|---|
| PubChem CID | 70184922 |
| Molecular Formula | C38H62N6O2 |
| Molecular Weight | 634.95 g/mol |
| Exact Mass | 634.49 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-1-[[(1S,3S)-3-[[[4-(dimethylamino)phenyl]carbamoyl-hexylamino]methyl]cyclohexyl]methyl]-1-hexylurea |
| SMILES | CCCCCCN(C[C@H]1CCC[C@H](CN(CCCCCC)C(=O)Nc2ccc(N(C)C)cc2)C1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C38H62N6O2/c1-7-9-11-13-26-43(37(45)39-33-18-22-35(23-19-33)41(3)4)29-31-16-15-17-32(28-31)30-44(27-14-12-10-8-2)38(46)40-34-20-24-36(25-21-34)42(5)6/h18-25,31-32H,7-17,26-30H2,1-6H3,(H,39,45)(H,40,46)/t31-,32-/m0/s1 |
| InChIKey | FVBKWZMEAITAPL-ACHIHNKUSA-N |
| XLogP | 9.15 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.95 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|