C36H58N6O2 — CID 70185239
3-[4-(dimethylamino)phenyl]-1-[[4-[[[4-(dimethylamino)phenyl]carbamoyl-pentylamino]methyl]cyclohexyl]methyl]-1-pentylurea (PubChem CID 70185239) has the molecular formula C36H58N6O2 and a molecular weight of 606.90 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-1-[[4-[[[4-(dimethylamino)phenyl]carbamoyl-pentylamino]methyl]cyclohexyl]methyl]-1-pentylurea.
| Compound Name | 3-[4-(dimethylamino)phenyl]-1-[[4-[[[4-(dimethylamino)phenyl]carbamoyl-pentylamino]methyl]cyclohexyl]methyl]-1-pentylurea |
|---|---|
| PubChem CID | 70185239 |
| Molecular Formula | C36H58N6O2 |
| Molecular Weight | 606.90 g/mol |
| Exact Mass | 606.46 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-1-[[4-[[[4-(dimethylamino)phenyl]carbamoyl-pentylamino]methyl]cyclohexyl]methyl]-1-pentylurea |
| SMILES | CCCCCN(CC1CCC(CN(CCCCC)C(=O)Nc2ccc(N(C)C)cc2)CC1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C36H58N6O2/c1-7-9-11-25-41(35(43)37-31-17-21-33(22-18-31)39(3)4)27-29-13-15-30(16-14-29)28-42(26-12-10-8-2)36(44)38-32-19-23-34(24-20-32)40(5)6/h17-24,29-30H,7-16,25-28H2,1-6H3,(H,37,43)(H,38,44) |
| InChIKey | PSIIVIQHHIZQBA-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.90 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|