C22H22N2O — CID 150299746
2,4,6-trimethyl-3,5-diphenylbenzohydrazide (PubChem CID 150299746) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is 2,4,6-trimethyl-3,5-diphenylbenzohydrazide.
| Compound Name | 2,4,6-trimethyl-3,5-diphenylbenzohydrazide |
|---|---|
| PubChem CID | 150299746 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2,4,6-trimethyl-3,5-diphenylbenzohydrazide |
| SMILES | Cc1c(C(=O)NN)c(C)c(-c2ccccc2)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C22H22N2O/c1-14-19(17-10-6-4-7-11-17)15(2)21(22(25)24-23)16(3)20(14)18-12-8-5-9-13-18/h4-13H,23H2,1-3H3,(H,24,25) |
| InChIKey | GJISMFAQHHIKID-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|