C22H17N3O — CID 69340657
3,4-diphenylquinoline-2-carbohydrazide (PubChem CID 69340657) has the molecular formula C22H17N3O and a molecular weight of 339.40 g/mol. Its IUPAC name is 3,4-diphenylquinoline-2-carbohydrazide.
| Compound Name | 3,4-diphenylquinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 69340657 |
| Molecular Formula | C22H17N3O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3,4-diphenylquinoline-2-carbohydrazide |
| SMILES | NNC(=O)c1nc2ccccc2c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H17N3O/c23-25-22(26)21-20(16-11-5-2-6-12-16)19(15-9-3-1-4-10-15)17-13-7-8-14-18(17)24-21/h1-14H,23H2,(H,25,26) |
| InChIKey | BDCQIPSVCGTSNL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|