C16H14N4O2 — CID 139611931
anthracene-9,10-dicarbohydrazide (PubChem CID 139611931) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is anthracene-9,10-dicarbohydrazide.
| Compound Name | anthracene-9,10-dicarbohydrazide |
|---|---|
| PubChem CID | 139611931 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | anthracene-9,10-dicarbohydrazide |
| SMILES | NNC(=O)c1c2ccccc2c(C(=O)NN)c2ccccc12 |
| InChI | InChI=1S/C16H14N4O2/c17-19-15(21)13-9-5-1-2-6-10(9)14(16(22)20-18)12-8-4-3-7-11(12)13/h1-8H,17-18H2,(H,19,21)(H,20,22) |
| InChIKey | IGKBISGARKCOMS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|