C19H19N3 — CID 141121042
4-(4-aminophenyl)-3-(2-methylphenyl)benzene-1,2-diamine (PubChem CID 141121042) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-(4-aminophenyl)-3-(2-methylphenyl)benzene-1,2-diamine.
| Compound Name | 4-(4-aminophenyl)-3-(2-methylphenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 141121042 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 4-(4-aminophenyl)-3-(2-methylphenyl)benzene-1,2-diamine |
| SMILES | Cc1ccccc1-c1c(-c2ccc(N)cc2)ccc(N)c1N |
| InChI | InChI=1S/C19H19N3/c1-12-4-2-3-5-15(12)18-16(10-11-17(21)19(18)22)13-6-8-14(20)9-7-13/h2-11H,20-22H2,1H3 |
| InChIKey | PRWYMRMHVCAWAH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|