C18H20N2O3 — CID 141058032
2-N-(1-hydroxy-2-methylpropan-2-yl)-3-phenylbenzene-1,2-dicarboxamide (PubChem CID 141058032) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-N-(1-hydroxy-2-methylpropan-2-yl)-3-phenylbenzene-1,2-dicarboxamide.
| Compound Name | 2-N-(1-hydroxy-2-methylpropan-2-yl)-3-phenylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 141058032 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-N-(1-hydroxy-2-methylpropan-2-yl)-3-phenylbenzene-1,2-dicarboxamide |
| SMILES | CC(C)(CO)NC(=O)c1c(C(N)=O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-18(2,11-21)20-17(23)15-13(12-7-4-3-5-8-12)9-6-10-14(15)16(19)22/h3-10,21H,11H2,1-2H3,(H2,19,22)(H,20,23) |
| InChIKey | SQYPHCNVPGRRSU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |