C11H15NO5 — CID 122625737
2-hydroxybenzamide;2-hydroxybutanoic acid (PubChem CID 122625737) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-hydroxybenzamide;2-hydroxybutanoic acid.
| Compound Name | 2-hydroxybenzamide;2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 122625737 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-hydroxybenzamide;2-hydroxybutanoic acid |
| SMILES | CCC(O)C(=O)O.NC(=O)c1ccccc1O |
| InChI | InChI=1S/C7H7NO2.C4H8O3/c8-7(10)5-3-1-2-4-6(5)9;1-2-3(5)4(6)7/h1-4,9H,(H2,8,10);3,5H,2H2,1H3,(H,6,7) |
| InChIKey | XUOOTGBHLKDNAM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |