C16H14N2O4 — CID 142626315
(Z)-2,3-bis(2-hydroxyphenyl)but-2-enediamide (PubChem CID 142626315) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is (Z)-2,3-bis(2-hydroxyphenyl)but-2-enediamide.
| Compound Name | (Z)-2,3-bis(2-hydroxyphenyl)but-2-enediamide |
|---|---|
| PubChem CID | 142626315 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (Z)-2,3-bis(2-hydroxyphenyl)but-2-enediamide |
| SMILES | NC(=O)/C(=C(\C(N)=O)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C16H14N2O4/c17-15(21)13(9-5-1-3-7-11(9)19)14(16(18)22)10-6-2-4-8-12(10)20/h1-8,19-20H,(H2,17,21)(H2,18,22)/b14-13- |
| InChIKey | BHYMZTGRIZBMIY-YPKPFQOOSA-N |
| XLogP | 0.98 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|