C16H21N — CID 82242576
2-[2-(3-methylphenyl)cycloheptyl]acetonitrile (PubChem CID 82242576) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[2-(3-methylphenyl)cycloheptyl]acetonitrile.
| Compound Name | 2-[2-(3-methylphenyl)cycloheptyl]acetonitrile |
|---|---|
| PubChem CID | 82242576 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2-[2-(3-methylphenyl)cycloheptyl]acetonitrile |
| SMILES | Cc1cccc(C2CCCCCC2CC#N)c1 |
| InChI | InChI=1S/C16H21N/c1-13-6-5-8-15(12-13)16-9-4-2-3-7-14(16)10-11-17/h5-6,8,12,14,16H,2-4,7,9-10H2,1H3 |
| InChIKey | XNOFIJSRPMNYRD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |